About Pestalafuranone A
Pestalafuranone A (PubChem CID 101899002) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(3-oxobutyl)-4-[(E)-prop-1-enyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | Pestalafuranone A |
| PubChem CID | 101899002 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-(3-oxobutyl)-4-[(E)-prop-1-enyl]-2H-furan-5-one |
| SMILES | C/C=C/C1=C(COC1=O)CCC(=O)C |
| InChI | InChI=1S/C11H14O3/c1-3-4-10-9(6-5-8(2)12)7-14-11(10)13/h3-4H,5-7H2,1-2H3/b4-3+ |
| InChIKey | CYBXGUDOSRPABU-ONEGZZNKSA-N |
| XLogP | 0.70 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 310 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Pestalafuranone A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pestalafuranone A?
The IUPAC name of Pestalafuranone A (CID 101899002) is 3-(3-oxobutyl)-4-[(E)-prop-1-enyl]-2H-furan-5-one.
What is the SMILES notation for Pestalafuranone A?
The canonical SMILES for Pestalafuranone A is C/C=C/C1=C(COC1=O)CCC(=O)C.
What is the InChIKey of Pestalafuranone A?
The InChIKey is CYBXGUDOSRPABU-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H14O3/c1-3-4-10-9(6-5-8(2)12)7-14-11(10)13/h3-4H,5-7H2,1-2H3/b4-3+.
What are the key properties of Pestalafuranone A?
Pestalafuranone A has a molecular weight of 194.23 g/mol, XLogP of 0.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Pestalafuranone A is sourced from PubChem (CID 101899002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).