C39H38F5N3O2 — CID 10190060
9-[4-[4-[[2-[4-(difluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 10190060) has the molecular formula C39H38F5N3O2 and a molecular weight of 675.74 g/mol. Its IUPAC name is 9-[4-[4-[[2-[4-(difluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[[2-[4-(difluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 10190060 |
| Molecular Formula | C39H38F5N3O2 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | 9-[4-[4-[[2-[4-(difluoromethyl)phenyl]benzoyl]amino]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccccc1-c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C39H38F5N3O2/c40-35(41)27-17-15-26(16-18-27)29-9-1-2-12-32(29)36(48)46-28-19-23-47(24-20-28)22-8-7-21-38(37(49)45-25-39(42,43)44)33-13-5-3-10-30(33)31-11-4-6-14-34(31)38/h1-6,9-18,28,35H,7-8,19-25H2,(H,45,49)(H,46,48) |
| InChIKey | CLNOEYRQIPOIHC-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|