C32H30F3N7O6S — CID 10190260
5-(2-methoxyphenoxy)-N-[(4-propan-2-ylphenyl)sulfamoyl]-2-pyridin-4-yl-6-[2-[5-(trifluoromethyl)pyrimidin-2-yl]oxyethoxy]pyrimidin-4-amine (PubChem CID 10190260) has the molecular formula C32H30F3N7O6S and a molecular weight of 697.70 g/mol. Its IUPAC name is 5-(2-methoxyphenoxy)-N-[(4-propan-2-ylphenyl)sulfamoyl]-2-pyridin-4-yl-6-[2-[5-(trifluoromethyl)pyrimidin-2-yl]oxyethoxy]pyrimidin-4-amine.
| Compound Name | 5-(2-methoxyphenoxy)-N-[(4-propan-2-ylphenyl)sulfamoyl]-2-pyridin-4-yl-6-[2-[5-(trifluoromethyl)pyrimidin-2-yl]oxyethoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10190260 |
| Molecular Formula | C32H30F3N7O6S |
| Molecular Weight | 697.70 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | 5-(2-methoxyphenoxy)-N-[(4-propan-2-ylphenyl)sulfamoyl]-2-pyridin-4-yl-6-[2-[5-(trifluoromethyl)pyrimidin-2-yl]oxyethoxy]pyrimidin-4-amine |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)Nc2ccc(C(C)C)cc2)nc(-c2ccncc2)nc1OCCOc1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C32H30F3N7O6S/c1-20(2)21-8-10-24(11-9-21)41-49(43,44)42-29-27(48-26-7-5-4-6-25(26)45-3)30(40-28(39-29)22-12-14-36-15-13-22)46-16-17-47-31-37-18-23(19-38-31)32(33,34)35/h4-15,18-20,41H,16-17H2,1-3H3,(H,39,40,42) |
| InChIKey | CEHGOGVRIOOVKI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|