C41H29F6N3O4 — CID 10190586
9-[3-[2,3-dioxo-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indol-1-yl]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 10190586) has the molecular formula C41H29F6N3O4 and a molecular weight of 741.69 g/mol. Its IUPAC name is 9-[3-[2,3-dioxo-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indol-1-yl]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[3-[2,3-dioxo-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indol-1-yl]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 10190586 |
| Molecular Formula | C41H29F6N3O4 |
| Molecular Weight | 741.69 g/mol |
| Exact Mass | 741.21 |
| IUPAC Name | 9-[3-[2,3-dioxo-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indol-1-yl]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)C(=O)N2CCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C41H29F6N3O4/c42-40(43,44)23-48-38(54)39(32-12-5-3-9-28(32)29-10-4-6-13-33(29)39)20-7-21-50-34-19-18-26(22-31(34)35(51)37(50)53)49-36(52)30-11-2-1-8-27(30)24-14-16-25(17-15-24)41(45,46)47/h1-6,8-19,22H,7,20-21,23H2,(H,48,54)(H,49,52) |
| InChIKey | DMJXPIIZGDDVQW-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.69 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|