About copper(1+);1,4-diazabicyclo[2.2.2]octane
copper(1+);1,4-diazabicyclo[2.2.2]octane (PubChem CID 10192600) has the molecular formula C6H12CuN2+
and a molecular weight of 175.72 g/mol. Its IUPAC name is copper(1+);1,4-diazabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | copper(1+);1,4-diazabicyclo[2.2.2]octane |
| PubChem CID | 10192600 |
| Molecular Formula | C6H12CuN2+ |
| Molecular Weight | 175.72 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | copper(1+);1,4-diazabicyclo[2.2.2]octane |
| SMILES | C1CN2CCN1CC2.[Cu+] |
| InChI | InChI=1S/C6H12N2.Cu/c1-2-8-5-3-7(1)4-6-8;/h1-6H2;/q;+1 |
| InChIKey | IWNVNGOGOORNMG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.72 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper(1+);1,4-diazabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1,4-diazabicyclo[2.2.2]octane?
The IUPAC name of copper(1+);1,4-diazabicyclo[2.2.2]octane (CID 10192600) is copper(1+);1,4-diazabicyclo[2.2.2]octane.
What is the SMILES notation for copper(1+);1,4-diazabicyclo[2.2.2]octane?
The canonical SMILES for copper(1+);1,4-diazabicyclo[2.2.2]octane is C1CN2CCN1CC2.[Cu+].
What is the InChIKey of copper(1+);1,4-diazabicyclo[2.2.2]octane?
The InChIKey is IWNVNGOGOORNMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.Cu/c1-2-8-5-3-7(1)4-6-8;/h1-6H2;/q;+1.
What are the key properties of copper(1+);1,4-diazabicyclo[2.2.2]octane?
copper(1+);1,4-diazabicyclo[2.2.2]octane has a molecular weight of 175.72 g/mol, XLogP of -0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1,4-diazabicyclo[2.2.2]octane is sourced from PubChem (CID 10192600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).