About 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine
4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine (PubChem CID 10192635) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 10192635 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1nc(C2CC2)nc2c1CCN2 |
| InChI | InChI=1S/C9H10ClN3/c10-7-6-3-4-11-9(6)13-8(12-7)5-1-2-5/h5H,1-4H2,(H,11,12,13) |
| InChIKey | HDVSMWOKBHCLFT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine (CID 10192635) is 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine is Clc1nc(C2CC2)nc2c1CCN2.
What is the InChIKey of 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is HDVSMWOKBHCLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3/c10-7-6-3-4-11-9(6)13-8(12-7)5-1-2-5/h5H,1-4H2,(H,11,12,13).
What are the key properties of 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine?
4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 195.65 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-cyclopropyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 10192635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).