About 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide
1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide (PubChem CID 10192898) has the molecular formula C10H13N3O2S2
and a molecular weight of 271.37 g/mol. Its IUPAC name is 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide |
| PubChem CID | 10192898 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide |
| SMILES | CCN1c2nc(SC)ncc2C=C(C)S1(=O)=O |
| InChI | InChI=1S/C10H13N3O2S2/c1-4-13-9-8(5-7(2)17(13,14)15)6-11-10(12-9)16-3/h5-6H,4H2,1-3H3 |
| InChIKey | ZSACPLPEFRUDHI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide?
The IUPAC name of 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide (CID 10192898) is 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide.
What is the SMILES notation for 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide?
The canonical SMILES for 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide is CCN1c2nc(SC)ncc2C=C(C)S1(=O)=O.
What is the InChIKey of 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide?
The InChIKey is ZSACPLPEFRUDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S2/c1-4-13-9-8(5-7(2)17(13,14)15)6-11-10(12-9)16-3/h5-6H,4H2,1-3H3.
What are the key properties of 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide?
1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide has a molecular weight of 271.37 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-7-methylsulfanylpyrimido[4,5-c]thiazine 2,2-dioxide is sourced from PubChem (CID 10192898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).