C21H28O2 — CID 10193233
5,9-dimethyl-5-(4-methylpent-3-enyl)-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene (PubChem CID 10193233) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 5,9-dimethyl-5-(4-methylpent-3-enyl)-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene.
| Compound Name | 5,9-dimethyl-5-(4-methylpent-3-enyl)-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene |
|---|---|
| PubChem CID | 10193233 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 5,9-dimethyl-5-(4-methylpent-3-enyl)-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene |
| SMILES | CC(C)=CCCC1(C)Oc2cc(C)cc3c2C2CC(CCC21)O3 |
| InChI | InChI=1S/C21H28O2/c1-13(2)6-5-9-21(4)17-8-7-15-12-16(17)20-18(22-15)10-14(3)11-19(20)23-21/h6,10-11,15-17H,5,7-9,12H2,1-4H3 |
| InChIKey | SZUYPQRIEWIXKW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|