About trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one
trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one (PubChem CID 10193458) has the molecular formula C18H28O2SSi
and a molecular weight of 336.57 g/mol. Its IUPAC name is trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one |
| PubChem CID | 10193458 |
| Molecular Formula | C18H28O2SSi |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one |
| SMILES | Cc1ccc(S[C@H]2CC(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O2SSi/c1-13-7-9-15(10-8-13)21-17-12-14(19)11-16(17)20-22(5,6)18(2,3)4/h7-10,16-17H,11-12H2,1-6H3/t16-,17-/m0/s1 |
| InChIKey | UCSWDIQIIKSIIH-IRXDYDNUSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one?
The IUPAC name of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one (CID 10193458) is trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one.
What is the SMILES notation for trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one?
The canonical SMILES for trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one is Cc1ccc(S[C@H]2CC(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C)cc1.
What is the InChIKey of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one?
The InChIKey is UCSWDIQIIKSIIH-IRXDYDNUSA-N. The full InChI is InChI=1S/C18H28O2SSi/c1-13-7-9-15(10-8-13)21-17-12-14(19)11-16(17)20-22(5,6)18(2,3)4/h7-10,16-17H,11-12H2,1-6H3/t16-,17-/m0/s1.
What are the key properties of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one?
trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one has a molecular weight of 336.57 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfanylcyclopentan-1-one is sourced from PubChem (CID 10193458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).