C13H17N5O5S — CID 10193667
5-amino-7-(cyclopropylamino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 10193667) has the molecular formula C13H17N5O5S and a molecular weight of 355.38 g/mol. Its IUPAC name is 5-amino-7-(cyclopropylamino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 5-amino-7-(cyclopropylamino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 10193667 |
| Molecular Formula | C13H17N5O5S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 5-amino-7-(cyclopropylamino)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | Nc1nc(NC2CC2)c2sc(=O)n([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C13H17N5O5S/c14-12-16-9(15-4-1-2-4)8-10(17-12)18(13(22)24-8)11-7(21)6(20)5(3-19)23-11/h4-7,11,19-21H,1-3H2,(H3,14,15,16,17)/t5-,6-,7-,11-/m1/s1 |
| InChIKey | NATDZUWOTJGURB-OJKLQORTSA-N |
| XLogP | -1.38 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |