C17H17BrN4 — CID 10193693
N'-[7-(4-bromophenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10193693) has the molecular formula C17H17BrN4 and a molecular weight of 357.25 g/mol. Its IUPAC name is N'-[7-(4-bromophenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[7-(4-bromophenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10193693 |
| Molecular Formula | C17H17BrN4 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N'-[7-(4-bromophenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | NCCCNc1nc(-c2ccc(Br)cc2)cc2ncccc12 |
| InChI | InChI=1S/C17H17BrN4/c18-13-6-4-12(5-7-13)15-11-16-14(3-1-9-20-16)17(22-15)21-10-2-8-19/h1,3-7,9,11H,2,8,10,19H2,(H,21,22) |
| InChIKey | DEPZWPCYJCJMNI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|