C24H24N4 — CID 10193837
N'-[7-[4-(4-methylphenyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10193837) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is N'-[7-[4-(4-methylphenyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[7-[4-(4-methylphenyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10193837 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N'-[7-[4-(4-methylphenyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | Cc1ccc(-c2ccc(-c3cc4ncccc4c(NCCCN)n3)cc2)cc1 |
| InChI | InChI=1S/C24H24N4/c1-17-5-7-18(8-6-17)19-9-11-20(12-10-19)22-16-23-21(4-2-14-26-23)24(28-22)27-15-3-13-25/h2,4-12,14,16H,3,13,15,25H2,1H3,(H,27,28) |
| InChIKey | OAVRODHKGRKOPG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|