C21H19Cl2N3 — CID 10194033
5-(aminomethyl)-6-(2,4-dichlorophenyl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine (PubChem CID 10194033) has the molecular formula C21H19Cl2N3 and a molecular weight of 384.31 g/mol. Its IUPAC name is 5-(aminomethyl)-6-(2,4-dichlorophenyl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine.
| Compound Name | 5-(aminomethyl)-6-(2,4-dichlorophenyl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 10194033 |
| Molecular Formula | C21H19Cl2N3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 5-(aminomethyl)-6-(2,4-dichlorophenyl)-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine |
| SMILES | NCc1c(N)nc2c(c1-c1ccc(Cl)cc1Cl)CCCc1ccccc1-2 |
| InChI | InChI=1S/C21H19Cl2N3/c22-13-8-9-15(18(23)10-13)19-16-7-3-5-12-4-1-2-6-14(12)20(16)26-21(25)17(19)11-24/h1-2,4,6,8-10H,3,5,7,11,24H2,(H2,25,26) |
| InChIKey | HUYBXZCKTQDAOA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |