C15H18O4S — CID 101941004
S-methyl (1R,4R,8R,12R)-1-methoxy-9-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate (PubChem CID 101941004) has the molecular formula C15H18O4S and a molecular weight of 294.40 g/mol. Its IUPAC name is S-methyl (1R,4R,8R,12R)-1-methoxy-9-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate.
| Compound Name | S-methyl (1R,4R,8R,12R)-1-methoxy-9-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate |
|---|---|
| PubChem CID | 101941004 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | S-methyl (1R,4R,8R,12R)-1-methoxy-9-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate |
| SMILES | CC1=CC(=O)[C@]2([C@H]3[C@@]1(CC=C[C@H]3CO2)C(=O)SC)OC |
| InChI | InChI=1S/C15H18O4S/c1-9-7-11(16)15(18-2)12-10(8-19-15)5-4-6-14(9,12)13(17)20-3/h4-5,7,10,12H,6,8H2,1-3H3/t10-,12+,14-,15-/m0/s1 |
| InChIKey | CAFQMLJYWJTZRA-FDEJFUCISA-N |
| XLogP | 1.10 |
| TPSA | 77.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 538 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|