C18H12F3N3O2S — CID 10194147
2-[6-methyl-3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid (PubChem CID 10194147) has the molecular formula C18H12F3N3O2S and a molecular weight of 391.37 g/mol. Its IUPAC name is 2-[6-methyl-3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid.
| Compound Name | 2-[6-methyl-3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10194147 |
| Molecular Formula | C18H12F3N3O2S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-[6-methyl-3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid |
| SMILES | Cc1ccc2c(Cc3nc4c(F)c(F)cc(F)c4s3)cn(CC(=O)O)c2n1 |
| InChI | InChI=1S/C18H12F3N3O2S/c1-8-2-3-10-9(6-24(7-14(25)26)18(10)22-8)4-13-23-16-15(21)11(19)5-12(20)17(16)27-13/h2-3,5-6H,4,7H2,1H3,(H,25,26) |
| InChIKey | JWXQDSJKVIYMHR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|