C21H19F3N4O — CID 10194291
4-[(3S)-3-phenylmorpholin-4-yl]-N-[(2,3,4-trifluorophenyl)methyl]pyrimidin-2-amine (PubChem CID 10194291) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is 4-[(3S)-3-phenylmorpholin-4-yl]-N-[(2,3,4-trifluorophenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-[(3S)-3-phenylmorpholin-4-yl]-N-[(2,3,4-trifluorophenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10194291 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[(3S)-3-phenylmorpholin-4-yl]-N-[(2,3,4-trifluorophenyl)methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(CNc2nccc(N3CCOC[C@@H]3c3ccccc3)n2)c(F)c1F |
| InChI | InChI=1S/C21H19F3N4O/c22-16-7-6-15(19(23)20(16)24)12-26-21-25-9-8-18(27-21)28-10-11-29-13-17(28)14-4-2-1-3-5-14/h1-9,17H,10-13H2,(H,25,26,27)/t17-/m1/s1 |
| InChIKey | WTJJGOVXDPHYAP-QGZVFWFLSA-N |
| XLogP | 4.08 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|