C25H22N2O — CID 10194337
3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-5H-phenanthridin-6-one (PubChem CID 10194337) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-5H-phenanthridin-6-one.
| Compound Name | 3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 10194337 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-5H-phenanthridin-6-one |
| SMILES | O=c1[nH]c2cc(CN3CC=C(c4ccccc4)CC3)ccc2c2ccccc12 |
| InChI | InChI=1S/C25H22N2O/c28-25-23-9-5-4-8-21(23)22-11-10-18(16-24(22)26-25)17-27-14-12-20(13-15-27)19-6-2-1-3-7-19/h1-12,16H,13-15,17H2,(H,26,28) |
| InChIKey | RXXRSJMPZOLNLZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|