About 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid
4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid (PubChem CID 10194688) has the molecular formula C28H24O2S
and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid |
| PubChem CID | 10194688 |
| Molecular Formula | C28H24O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid |
| SMILES | Cc1ccc(C2=CCC(C)(C)c3cc4ccc(-c5ccc(C(=O)O)cc5)cc4cc32)s1 |
| InChI | InChI=1S/C28H24O2S/c1-17-4-11-26(31-17)23-12-13-28(2,3)25-16-21-10-9-20(14-22(21)15-24(23)25)18-5-7-19(8-6-18)27(29)30/h4-12,14-16H,13H2,1-3H3,(H,29,30) |
| InChIKey | VGAAIQMKJKFJSO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid?
The IUPAC name of 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid (CID 10194688) is 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid.
What is the SMILES notation for 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid?
The canonical SMILES for 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid is Cc1ccc(C2=CCC(C)(C)c3cc4ccc(-c5ccc(C(=O)O)cc5)cc4cc32)s1.
What is the InChIKey of 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid?
The InChIKey is VGAAIQMKJKFJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24O2S/c1-17-4-11-26(31-17)23-12-13-28(2,3)25-16-21-10-9-20(14-22(21)15-24(23)25)18-5-7-19(8-6-18)27(29)30/h4-12,14-16H,13H2,1-3H3,(H,29,30).
What are the key properties of 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid?
4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid has a molecular weight of 424.57 g/mol, XLogP of 7.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5,5-dimethyl-8-(5-methylthiophen-2-yl)-6H-anthracen-2-yl]benzoic acid is sourced from PubChem (CID 10194688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).