About 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine
5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine (PubChem CID 10194700) has the molecular formula C22H18Cl2N4O
and a molecular weight of 425.32 g/mol. Its IUPAC name is 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine |
| PubChem CID | 10194700 |
| Molecular Formula | C22H18Cl2N4O |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine |
| SMILES | COc1ccc2cc(-c3nc(N)c(CN)c(-c4ccc(Cl)cc4Cl)n3)ccc2c1 |
| InChI | InChI=1S/C22H18Cl2N4O/c1-29-16-6-4-12-8-14(3-2-13(12)9-16)22-27-20(18(11-25)21(26)28-22)17-7-5-15(23)10-19(17)24/h2-10H,11,25H2,1H3,(H2,26,27,28) |
| InChIKey | GMPOWYVNDCOTBA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine?
The IUPAC name of 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine (CID 10194700) is 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine?
The canonical SMILES for 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine is COc1ccc2cc(-c3nc(N)c(CN)c(-c4ccc(Cl)cc4Cl)n3)ccc2c1.
What is the InChIKey of 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine?
The InChIKey is GMPOWYVNDCOTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2N4O/c1-29-16-6-4-12-8-14(3-2-13(12)9-16)22-27-20(18(11-25)21(26)28-22)17-7-5-15(23)10-19(17)24/h2-10H,11,25H2,1H3,(H2,26,27,28).
What are the key properties of 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine?
5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine has a molecular weight of 425.32 g/mol, XLogP of 5.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-6-(2,4-dichlorophenyl)-2-(6-methoxynaphthalen-2-yl)pyrimidin-4-amine is sourced from PubChem (CID 10194700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).