C23H22FN7O — CID 10194801
5-(2-aminoethoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 10194801) has the molecular formula C23H22FN7O and a molecular weight of 431.48 g/mol. Its IUPAC name is 5-(2-aminoethoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-aminoethoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 10194801 |
| Molecular Formula | C23H22FN7O |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 5-(2-aminoethoxymethyl)-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | NCCOCc1ccn2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C23H22FN7O/c24-19-3-1-2-16(10-19)13-31-21-5-4-20(11-18(21)12-27-31)29-23-22-17(14-32-9-7-25)6-8-30(22)28-15-26-23/h1-6,8,10-12,15H,7,9,13-14,25H2,(H,26,28,29) |
| InChIKey | JFPGALAHAHQULC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|