C21H21F2N3O5 — CID 10194831
3-[[2-[[(1S)-2,2-difluoro-1-(4-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 10194831) has the molecular formula C21H21F2N3O5 and a molecular weight of 433.41 g/mol. Its IUPAC name is 3-[[2-[[(1S)-2,2-difluoro-1-(4-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[(1S)-2,2-difluoro-1-(4-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 10194831 |
| Molecular Formula | C21H21F2N3O5 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-[[2-[[(1S)-2,2-difluoro-1-(4-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | Cc1coc([C@H](Nc2c(Nc3cccc(C(=O)N(C)C)c3O)c(=O)c2=O)C(C)(F)F)c1 |
| InChI | InChI=1S/C21H21F2N3O5/c1-10-8-13(31-9-10)19(21(2,22)23)25-15-14(17(28)18(15)29)24-12-7-5-6-11(16(12)27)20(30)26(3)4/h5-9,19,24-25,27H,1-4H3/t19-/m0/s1 |
| InChIKey | NICQNGMZJXZBJM-IBGZPJMESA-N |
| XLogP | 3.14 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|