C21H20F3N3O4 — CID 10194869
(E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 10194869) has the molecular formula C21H20F3N3O4 and a molecular weight of 435.40 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 10194869 |
| Molecular Formula | C21H20F3N3O4 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (E)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)nc1N1CCOCC1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H20F3N3O4/c22-21(23,24)18-5-1-14(20(26-18)27-7-9-29-10-8-27)2-6-19(28)25-15-3-4-16-17(13-15)31-12-11-30-16/h1-6,13H,7-12H2,(H,25,28)/b6-2+ |
| InChIKey | CCCAZXHLWPASRC-QHHAFSJGSA-N |
| XLogP | 3.36 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|