C28H41NO2Si — CID 10195175
2-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]ethanol (PubChem CID 10195175) has the molecular formula C28H41NO2Si and a molecular weight of 451.73 g/mol. Its IUPAC name is 2-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]ethanol.
| Compound Name | 2-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]ethanol |
|---|---|
| PubChem CID | 10195175 |
| Molecular Formula | C28H41NO2Si |
| Molecular Weight | 451.73 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 2-[(4S,5S,7R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azaspiro[4.5]decan-7-yl]ethanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1CCC[C@]12CCC[C@H](CCO)N2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H41NO2Si/c1-27(2,3)32(25-14-6-4-7-15-25,26-16-8-5-9-17-26)31-22-23-12-10-19-28(23)20-11-13-24(29-28)18-21-30/h4-9,14-17,23-24,29-30H,10-13,18-22H2,1-3H3/t23-,24-,28+/m1/s1 |
| InChIKey | BWDKXGSTNZZAEM-GKAFBRTNSA-N |
| XLogP | 4.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|