C26H30FNO3S — CID 10195222
3-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10195222) has the molecular formula C26H30FNO3S and a molecular weight of 455.60 g/mol. Its IUPAC name is 3-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10195222 |
| Molecular Formula | C26H30FNO3S |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-[[3-fluoro-4-methoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1c(F)cc(CN2C(=O)CSC2=O)cc1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30FNO3S/c1-15-9-19-20(26(4,5)8-7-25(19,2)3)12-17(15)18-10-16(11-21(27)23(18)31-6)13-28-22(29)14-32-24(28)30/h9-12H,7-8,13-14H2,1-6H3 |
| InChIKey | CCDLSVOROJLLAS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|