About 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid
3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid (PubChem CID 10195696) has the molecular formula C25H19BrF2O3
and a molecular weight of 485.32 g/mol. Its IUPAC name is 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid |
| PubChem CID | 10195696 |
| Molecular Formula | C25H19BrF2O3 |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2=C(c3cc(Br)ccc3OCc3ccc(F)cc3F)CCC2)c1 |
| InChI | InChI=1S/C25H19BrF2O3/c26-18-8-10-24(31-14-17-7-9-19(27)13-23(17)28)22(12-18)21-6-2-5-20(21)15-3-1-4-16(11-15)25(29)30/h1,3-4,7-13H,2,5-6,14H2,(H,29,30) |
| InChIKey | CIDNAJYJXLHGAR-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid?
The IUPAC name of 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid (CID 10195696) is 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid.
What is the SMILES notation for 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid?
The canonical SMILES for 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid is O=C(O)c1cccc(C2=C(c3cc(Br)ccc3OCc3ccc(F)cc3F)CCC2)c1.
What is the InChIKey of 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid?
The InChIKey is CIDNAJYJXLHGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19BrF2O3/c26-18-8-10-24(31-14-17-7-9-19(27)13-23(17)28)22(12-18)21-6-2-5-20(21)15-3-1-4-16(11-15)25(29)30/h1,3-4,7-13H,2,5-6,14H2,(H,29,30).
What are the key properties of 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid?
3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid has a molecular weight of 485.32 g/mol, XLogP of 7.10, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoic acid is sourced from PubChem (CID 10195696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).