C24H21ClFN3O4S — CID 10195951
6-chloro-N-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]pyridine-3-carboxamide (PubChem CID 10195951) has the molecular formula C24H21ClFN3O4S and a molecular weight of 501.97 g/mol. Its IUPAC name is 6-chloro-N-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10195951 |
| Molecular Formula | C24H21ClFN3O4S |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 6-chloro-N-[1-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-2-oxopiperidin-3-yl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccccc1-c1ccc(N2CCCC(NC(=O)c3ccc(Cl)nc3)C2=O)c(F)c1 |
| InChI | InChI=1S/C24H21ClFN3O4S/c1-34(32,33)21-7-3-2-5-17(21)15-8-10-20(18(26)13-15)29-12-4-6-19(24(29)31)28-23(30)16-9-11-22(25)27-14-16/h2-3,5,7-11,13-14,19H,4,6,12H2,1H3,(H,28,30) |
| InChIKey | ATGVFRNKNVIVLS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|