C28H29N7O3 — CID 10196061
2-(furan-2-yl)-7-[3-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]phenyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 10196061) has the molecular formula C28H29N7O3 and a molecular weight of 511.59 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-[3-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]phenyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 2-(furan-2-yl)-7-[3-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]phenyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 10196061 |
| Molecular Formula | C28H29N7O3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 2-(furan-2-yl)-7-[3-[4-[4-(2-methoxyethoxy)phenyl]piperazin-1-yl]phenyl]-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COCCOc1ccc(N2CCN(c3cccc(-c4cc5nc(-c6ccco6)nn5c(N)n4)c3)CC2)cc1 |
| InChI | InChI=1S/C28H29N7O3/c1-36-16-17-37-23-9-7-21(8-10-23)33-11-13-34(14-12-33)22-5-2-4-20(18-22)24-19-26-31-27(25-6-3-15-38-25)32-35(26)28(29)30-24/h2-10,15,18-19H,11-14,16-17H2,1H3,(H2,29,30) |
| InChIKey | HZAGRYSAEUKSAP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|