C25H23ClN6O3S — CID 10196198
6-[2-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylcarbamoyl)hydrazinyl]-5-chloro-N-(2-oxothiolan-3-yl)pyridine-3-carboxamide (PubChem CID 10196198) has the molecular formula C25H23ClN6O3S and a molecular weight of 523.02 g/mol. Its IUPAC name is 6-[2-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylcarbamoyl)hydrazinyl]-5-chloro-N-(2-oxothiolan-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylcarbamoyl)hydrazinyl]-5-chloro-N-(2-oxothiolan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10196198 |
| Molecular Formula | C25H23ClN6O3S |
| Molecular Weight | 523.02 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 6-[2-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylcarbamoyl)hydrazinyl]-5-chloro-N-(2-oxothiolan-3-yl)pyridine-3-carboxamide |
| SMILES | O=C(NNc1ncc(C(=O)NC2CCSC2=O)cc1Cl)NC1c2ccccc2CCc2cnccc21 |
| InChI | InChI=1S/C25H23ClN6O3S/c26-19-11-16(23(33)29-20-8-10-36-24(20)34)13-28-22(19)31-32-25(35)30-21-17-4-2-1-3-14(17)5-6-15-12-27-9-7-18(15)21/h1-4,7,9,11-13,20-21H,5-6,8,10H2,(H,28,31)(H,29,33)(H2,30,32,35) |
| InChIKey | LLJBRORJGVAETQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|