C32H58O9 — CID 10196778
(1,3,4-trihydroxy-5-methoxy-5-oxopentan-2-yl) (E)-13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoate (PubChem CID 10196778) has the molecular formula C32H58O9 and a molecular weight of 586.81 g/mol. Its IUPAC name is (1,3,4-trihydroxy-5-methoxy-5-oxopentan-2-yl) (E)-13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoate.
| Compound Name | (1,3,4-trihydroxy-5-methoxy-5-oxopentan-2-yl) (E)-13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoate |
|---|---|
| PubChem CID | 10196778 |
| Molecular Formula | C32H58O9 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.41 |
| IUPAC Name | (1,3,4-trihydroxy-5-methoxy-5-oxopentan-2-yl) (E)-13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoate |
| SMILES | CCCCCCCCCC(O)CCCCC(C)CC(C)/C=C(\C)C(=O)C(C)C(=O)OC(CO)C(O)C(O)C(=O)OC |
| InChI | InChI=1S/C32H58O9/c1-7-8-9-10-11-12-13-17-26(34)18-15-14-16-22(2)19-23(3)20-24(4)28(35)25(5)31(38)41-27(21-33)29(36)30(37)32(39)40-6/h20,22-23,25-27,29-30,33-34,36-37H,7-19,21H2,1-6H3/b24-20+ |
| InChIKey | QHPZOAHXDUCMHY-HIXSDJFHSA-N |
| XLogP | 4.66 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|