C22H27BrN4O9S — CID 10196872
(3S)-4-[[(2R)-1-acetylsulfanyl-3-[4-(oxaloamino)phenyl]propan-2-yl]amino]-3-[3-[(2-bromoacetyl)amino]propanoylamino]-4-oxobutanoic acid (PubChem CID 10196872) has the molecular formula C22H27BrN4O9S and a molecular weight of 603.45 g/mol. Its IUPAC name is (3S)-4-[[(2R)-1-acetylsulfanyl-3-[4-(oxaloamino)phenyl]propan-2-yl]amino]-3-[3-[(2-bromoacetyl)amino]propanoylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2R)-1-acetylsulfanyl-3-[4-(oxaloamino)phenyl]propan-2-yl]amino]-3-[3-[(2-bromoacetyl)amino]propanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10196872 |
| Molecular Formula | C22H27BrN4O9S |
| Molecular Weight | 603.45 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | (3S)-4-[[(2R)-1-acetylsulfanyl-3-[4-(oxaloamino)phenyl]propan-2-yl]amino]-3-[3-[(2-bromoacetyl)amino]propanoylamino]-4-oxobutanoic acid |
| SMILES | CC(=O)SC[C@@H](Cc1ccc(NC(=O)C(=O)O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)CCNC(=O)CBr |
| InChI | InChI=1S/C22H27BrN4O9S/c1-12(28)37-11-15(8-13-2-4-14(5-3-13)25-21(34)22(35)36)26-20(33)16(9-19(31)32)27-17(29)6-7-24-18(30)10-23/h2-5,15-16H,6-11H2,1H3,(H,24,30)(H,25,34)(H,26,33)(H,27,29)(H,31,32)(H,35,36)/t15-,16+/m1/s1 |
| InChIKey | GNOLVTRTBBOELF-CVEARBPZSA-N |
| XLogP | -0.12 |
| TPSA | 208.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|