C37H38ClF3N2O3 — CID 10197068
1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidine-4-carboxylic acid (PubChem CID 10197068) has the molecular formula C37H38ClF3N2O3 and a molecular weight of 651.17 g/mol. Its IUPAC name is 1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 10197068 |
| Molecular Formula | C37H38ClF3N2O3 |
| Molecular Weight | 651.17 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 1-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2cccc(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C37H38ClF3N2O3/c38-35-30(14-7-17-34(35)37(39,40)41)25-42(26-33(27-10-3-1-4-11-27)28-12-5-2-6-13-28)20-9-23-46-32-16-8-15-31(24-32)43-21-18-29(19-22-43)36(44)45/h1-8,10-17,24,29,33H,9,18-23,25-26H2,(H,44,45) |
| InChIKey | FVFGBNRDWYCJCZ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.17 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|