C6H13NO4 — CID 10197840
(3S,4R,5R)-5-(hydroxymethyl)piperidine-2,3,4-triol (PubChem CID 10197840) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (3S,4R,5R)-5-(hydroxymethyl)piperidine-2,3,4-triol.
| Compound Name | (3S,4R,5R)-5-(hydroxymethyl)piperidine-2,3,4-triol |
|---|---|
| PubChem CID | 10197840 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (3S,4R,5R)-5-(hydroxymethyl)piperidine-2,3,4-triol |
| SMILES | OC[C@H]1CNC(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c8-2-3-1-7-6(11)5(10)4(3)9/h3-11H,1-2H2/t3-,4-,5+,6?/m1/s1 |
| InChIKey | BHOYFRIRWXBNHP-VRPWFDPXSA-N |
| XLogP | -2.76 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |