C11H23N — CID 10197887
cis-(1R,5R)-5-ethyl-1,3,3-trimethylcyclohexan-1-amine (PubChem CID 10197887) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is cis-(1R,5R)-5-ethyl-1,3,3-trimethylcyclohexan-1-amine.
| Compound Name | cis-(1R,5R)-5-ethyl-1,3,3-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10197887 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | cis-(1R,5R)-5-ethyl-1,3,3-trimethylcyclohexan-1-amine |
| SMILES | CC[C@@H]1CC(C)(C)C[C@](C)(N)C1 |
| InChI | InChI=1S/C11H23N/c1-5-9-6-10(2,3)8-11(4,12)7-9/h9H,5-8,12H2,1-4H3/t9-,11-/m1/s1 |
| InChIKey | YENZSTRINXGOIJ-MWLCHTKSSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |