About 1-methylindole-3,5,6-triol
1-methylindole-3,5,6-triol (PubChem CID 10197941) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 1-methylindole-3,5,6-triol.
Molecular Properties
| Compound Name | 1-methylindole-3,5,6-triol |
| PubChem CID | 10197941 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 1-methylindole-3,5,6-triol |
| SMILES | Cn1cc(O)c2cc(O)c(O)cc21 |
| InChI | InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-4,11-13H,1H3 |
| InChIKey | DINWCUSJIVPQIO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindole-3,5,6-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindole-3,5,6-triol?
The IUPAC name of 1-methylindole-3,5,6-triol (CID 10197941) is 1-methylindole-3,5,6-triol.
What is the SMILES notation for 1-methylindole-3,5,6-triol?
The canonical SMILES for 1-methylindole-3,5,6-triol is Cn1cc(O)c2cc(O)c(O)cc21.
What is the InChIKey of 1-methylindole-3,5,6-triol?
The InChIKey is DINWCUSJIVPQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-10-4-9(13)5-2-7(11)8(12)3-6(5)10/h2-4,11-13H,1H3.
What are the key properties of 1-methylindole-3,5,6-triol?
1-methylindole-3,5,6-triol has a molecular weight of 179.17 g/mol, XLogP of 1.30, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindole-3,5,6-triol is sourced from PubChem (CID 10197941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).