C11H13N — CID 10198058
10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene (PubChem CID 10198058) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 10198058 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 10-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C1CNCC2C1 |
| InChI | InChI=1S/C11H13N/c1-2-4-11-9-5-8(6-12-7-9)10(11)3-1/h1-4,8-9,12H,5-7H2 |
| InChIKey | COMHUAMOJSTCMM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |