About (4-acetylphenyl) sulfamate
(4-acetylphenyl) sulfamate (PubChem CID 10198275) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is (4-acetylphenyl) sulfamate.
Molecular Properties
| Compound Name | (4-acetylphenyl) sulfamate |
| PubChem CID | 10198275 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (4-acetylphenyl) sulfamate |
| SMILES | CC(=O)c1ccc(OS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C8H9NO4S/c1-6(10)7-2-4-8(5-3-7)13-14(9,11)12/h2-5H,1H3,(H2,9,11,12) |
| InChIKey | NNULMIASCQGDTR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-acetylphenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl) sulfamate?
The IUPAC name of (4-acetylphenyl) sulfamate (CID 10198275) is (4-acetylphenyl) sulfamate.
What is the SMILES notation for (4-acetylphenyl) sulfamate?
The canonical SMILES for (4-acetylphenyl) sulfamate is CC(=O)c1ccc(OS(N)(=O)=O)cc1.
What is the InChIKey of (4-acetylphenyl) sulfamate?
The InChIKey is NNULMIASCQGDTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c1-6(10)7-2-4-8(5-3-7)13-14(9,11)12/h2-5H,1H3,(H2,9,11,12).
What are the key properties of (4-acetylphenyl) sulfamate?
(4-acetylphenyl) sulfamate has a molecular weight of 215.23 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl) sulfamate is sourced from PubChem (CID 10198275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).