About (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine
(2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine (PubChem CID 10198431) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine |
| PubChem CID | 10198431 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine |
| SMILES | C[C@H](N)Cn1ccc2ccc3ncccc3c21 |
| InChI | InChI=1S/C14H15N3/c1-10(15)9-17-8-6-11-4-5-13-12(14(11)17)3-2-7-16-13/h2-8,10H,9,15H2,1H3/t10-/m0/s1 |
| InChIKey | SDEXYLCQNBTWLI-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine?
The IUPAC name of (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine (CID 10198431) is (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine.
What is the SMILES notation for (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine?
The canonical SMILES for (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine is C[C@H](N)Cn1ccc2ccc3ncccc3c21.
What is the InChIKey of (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine?
The InChIKey is SDEXYLCQNBTWLI-JTQLQIEISA-N. The full InChI is InChI=1S/C14H15N3/c1-10(15)9-17-8-6-11-4-5-13-12(14(11)17)3-2-7-16-13/h2-8,10H,9,15H2,1H3/t10-/m0/s1.
What are the key properties of (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine?
(2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine has a molecular weight of 225.30 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-pyrrolo[2,3-f]quinolin-1-ylpropan-2-amine is sourced from PubChem (CID 10198431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).