About N-hexyl-2,4-dioxopyrimidine-1-carboxamide
N-hexyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 10198639) has the molecular formula C11H17N3O3
and a molecular weight of 239.27 g/mol. Its IUPAC name is N-hexyl-2,4-dioxopyrimidine-1-carboxamide.
Molecular Properties
| Compound Name | N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
| PubChem CID | 10198639 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O3/c1-2-3-4-5-7-12-10(16)14-8-6-9(15)13-11(14)17/h6,8H,2-5,7H2,1H3,(H,12,16)(H,13,15,17) |
| InChIKey | URIQHRVESCIELP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-2,4-dioxopyrimidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
The IUPAC name of N-hexyl-2,4-dioxopyrimidine-1-carboxamide (CID 10198639) is N-hexyl-2,4-dioxopyrimidine-1-carboxamide.
What is the SMILES notation for N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
The canonical SMILES for N-hexyl-2,4-dioxopyrimidine-1-carboxamide is CCCCCCNC(=O)n1ccc(=O)[nH]c1=O.
What is the InChIKey of N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
The InChIKey is URIQHRVESCIELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c1-2-3-4-5-7-12-10(16)14-8-6-9(15)13-11(14)17/h6,8H,2-5,7H2,1H3,(H,12,16)(H,13,15,17).
What are the key properties of N-hexyl-2,4-dioxopyrimidine-1-carboxamide?
N-hexyl-2,4-dioxopyrimidine-1-carboxamide has a molecular weight of 239.27 g/mol, XLogP of 0.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-2,4-dioxopyrimidine-1-carboxamide is sourced from PubChem (CID 10198639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).