C13H8FN3O — CID 10198663
13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one (PubChem CID 10198663) has the molecular formula C13H8FN3O and a molecular weight of 241.22 g/mol. Its IUPAC name is 13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one.
| Compound Name | 13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one |
|---|---|
| PubChem CID | 10198663 |
| Molecular Formula | C13H8FN3O |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one |
| SMILES | O=c1[nH]c2c(n3ccnc13)Cc1cc(F)ccc1-2 |
| InChI | InChI=1S/C13H8FN3O/c14-8-1-2-9-7(5-8)6-10-11(9)16-13(18)12-15-3-4-17(10)12/h1-5H,6H2,(H,16,18) |
| InChIKey | YPWUKJZDQGKQAW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |