About 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine
2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (PubChem CID 10198719) has the molecular formula C13H13N3S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| PubChem CID | 10198719 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| SMILES | CCCc1nc2c(N)nc3ccccc3c2s1 |
| InChI | InChI=1S/C13H13N3S/c1-2-5-10-16-11-12(17-10)8-6-3-4-7-9(8)15-13(11)14/h3-4,6-7H,2,5H2,1H3,(H2,14,15) |
| InChIKey | NFYMGJSUKCDVJR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The IUPAC name of 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (CID 10198719) is 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The canonical SMILES for 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine is CCCc1nc2c(N)nc3ccccc3c2s1.
What is the InChIKey of 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The InChIKey is NFYMGJSUKCDVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3S/c1-2-5-10-16-11-12(17-10)8-6-3-4-7-9(8)15-13(11)14/h3-4,6-7H,2,5H2,1H3,(H2,14,15).
What are the key properties of 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine has a molecular weight of 243.33 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 10198719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).