C12H9NO5 — CID 10198790
4,7,11,13-tetraoxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),5,9-tetraen-17-one (PubChem CID 10198790) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is 4,7,11,13-tetraoxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),5,9-tetraen-17-one.
| Compound Name | 4,7,11,13-tetraoxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),5,9-tetraen-17-one |
|---|---|
| PubChem CID | 10198790 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4,7,11,13-tetraoxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),5,9-tetraen-17-one |
| SMILES | O=C1c2cc3c(cc2OC2OCCN12)OC=CO3 |
| InChI | InChI=1S/C12H9NO5/c14-11-7-5-9-10(16-4-3-15-9)6-8(7)18-12-13(11)1-2-17-12/h3-6,12H,1-2H2 |
| InChIKey | NTMDACCKRDPCQX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |