About O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate
O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate (PubChem CID 10198868) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate |
| PubChem CID | 10198868 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate |
| SMILES | CNC(=S)OC[C@@H]1Cc2ccccc2CN1C |
| InChI | InChI=1S/C13H18N2OS/c1-14-13(17)16-9-12-7-10-5-3-4-6-11(10)8-15(12)2/h3-6,12H,7-9H2,1-2H3,(H,14,17)/t12-/m0/s1 |
| InChIKey | UHSUUFYEIIVJPR-LBPRGKRZSA-N |
| XLogP | 1.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate?
The IUPAC name of O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate (CID 10198868) is O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate.
What is the SMILES notation for O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate?
The canonical SMILES for O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate is CNC(=S)OC[C@@H]1Cc2ccccc2CN1C.
What is the InChIKey of O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate?
The InChIKey is UHSUUFYEIIVJPR-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-14-13(17)16-9-12-7-10-5-3-4-6-11(10)8-15(12)2/h3-6,12H,7-9H2,1-2H3,(H,14,17)/t12-/m0/s1.
What are the key properties of O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate?
O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate has a molecular weight of 250.37 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[(3S)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl] N-methylcarbamothioate is sourced from PubChem (CID 10198868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).