About 3,5-diphenyl-1,2-thiazol-4-ol
3,5-diphenyl-1,2-thiazol-4-ol (PubChem CID 10198936) has the molecular formula C15H11NOS
and a molecular weight of 253.33 g/mol. Its IUPAC name is 3,5-diphenyl-1,2-thiazol-4-ol.
Molecular Properties
| Compound Name | 3,5-diphenyl-1,2-thiazol-4-ol |
| PubChem CID | 10198936 |
| Molecular Formula | C15H11NOS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3,5-diphenyl-1,2-thiazol-4-ol |
| SMILES | Oc1c(-c2ccccc2)nsc1-c1ccccc1 |
| InChI | InChI=1S/C15H11NOS/c17-14-13(11-7-3-1-4-8-11)16-18-15(14)12-9-5-2-6-10-12/h1-10,17H |
| InChIKey | SJYPFVPMKGEEHD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diphenyl-1,2-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-1,2-thiazol-4-ol?
The IUPAC name of 3,5-diphenyl-1,2-thiazol-4-ol (CID 10198936) is 3,5-diphenyl-1,2-thiazol-4-ol.
What is the SMILES notation for 3,5-diphenyl-1,2-thiazol-4-ol?
The canonical SMILES for 3,5-diphenyl-1,2-thiazol-4-ol is Oc1c(-c2ccccc2)nsc1-c1ccccc1.
What is the InChIKey of 3,5-diphenyl-1,2-thiazol-4-ol?
The InChIKey is SJYPFVPMKGEEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NOS/c17-14-13(11-7-3-1-4-8-11)16-18-15(14)12-9-5-2-6-10-12/h1-10,17H.
What are the key properties of 3,5-diphenyl-1,2-thiazol-4-ol?
3,5-diphenyl-1,2-thiazol-4-ol has a molecular weight of 253.33 g/mol, XLogP of 4.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-1,2-thiazol-4-ol is sourced from PubChem (CID 10198936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).