C17H24O2 — CID 10199100
[(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)penta-1,2-dienyl] acetate (PubChem CID 10199100) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)penta-1,2-dienyl] acetate.
| Compound Name | [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)penta-1,2-dienyl] acetate |
|---|---|
| PubChem CID | 10199100 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)penta-1,2-dienyl] acetate |
| SMILES | CC(=O)OC=C=C(C)C/C=C1\C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H24O2/c1-13(10-12-19-15(3)18)8-9-16-14(2)7-6-11-17(16,4)5/h7,9,12H,6,8,11H2,1-5H3/b16-9+ |
| InChIKey | FKVOGSNBJWKWTI-CXUHLZMHSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|