About zinc diperchlorate
zinc diperchlorate (PubChem CID 10199167) has the molecular formula Cl2O8Zn
and a molecular weight of 264.29 g/mol. Its IUPAC name is zinc diperchlorate.
Molecular Properties
| Compound Name | zinc diperchlorate |
| PubChem CID | 10199167 |
| Molecular Formula | Cl2O8Zn |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 261.83 |
| IUPAC Name | zinc diperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].[Zn+2] |
| InChI | InChI=1S/2ClHO4.Zn/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/q;;+2/p-2 |
| InChIKey | RXBXBWBHKPGHIB-UHFFFAOYSA-L |
| XLogP | -9.51 |
| TPSA | 184.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc diperchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc diperchlorate?
The IUPAC name of zinc diperchlorate (CID 10199167) is zinc diperchlorate.
What is the SMILES notation for zinc diperchlorate?
The canonical SMILES for zinc diperchlorate is [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].[Zn+2].
What is the InChIKey of zinc diperchlorate?
The InChIKey is RXBXBWBHKPGHIB-UHFFFAOYSA-L. The full InChI is InChI=1S/2ClHO4.Zn/c2*2-1(3,4)5;/h2*(H,2,3,4,5);/q;;+2/p-2.
What are the key properties of zinc diperchlorate?
zinc diperchlorate has a molecular weight of 264.29 g/mol, XLogP of -9.51, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc diperchlorate is sourced from PubChem (CID 10199167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).