About 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline
4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 10199285) has the molecular formula C18H20FN
and a molecular weight of 269.36 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 10199285 |
| Molecular Formula | C18H20FN |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1cc(C2CN(C)Cc3c(C)cccc32)ccc1F |
| InChI | InChI=1S/C18H20FN/c1-12-5-4-6-15-16(12)10-20(3)11-17(15)14-7-8-18(19)13(2)9-14/h4-9,17H,10-11H2,1-3H3 |
| InChIKey | FYRPDWCCIGZKHQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline (CID 10199285) is 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline is Cc1cc(C2CN(C)Cc3c(C)cccc32)ccc1F.
What is the InChIKey of 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is FYRPDWCCIGZKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN/c1-12-5-4-6-15-16(12)10-20(3)11-17(15)14-7-8-18(19)13(2)9-14/h4-9,17H,10-11H2,1-3H3.
What are the key properties of 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline?
4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 269.36 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluoro-3-methylphenyl)-2,8-dimethyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 10199285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).