C13H15Cl4NO3 — CID 10199444
3-[(2R,3R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-4,5-dihydro-1,2-oxazole (PubChem CID 10199444) has the molecular formula C13H15Cl4NO3 and a molecular weight of 375.08 g/mol. Its IUPAC name is 3-[(2R,3R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-[(2R,3R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10199444 |
| Molecular Formula | C13H15Cl4NO3 |
| Molecular Weight | 375.08 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 3-[(2R,3R)-1,4,5,6-tetrachloro-7,7-dimethoxy-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-4,5-dihydro-1,2-oxazole |
| SMILES | COC1(OC)C2(Cl)C(Cl)=C(Cl)C1(Cl)[C@@H](C1=NOCC1)[C@H]2C |
| InChI | InChI=1S/C13H15Cl4NO3/c1-6-8(7-4-5-21-18-7)12(17)10(15)9(14)11(6,16)13(12,19-2)20-3/h6,8H,4-5H2,1-3H3/t6-,8-,11?,12?/m1/s1 |
| InChIKey | IWNVRCMCCWGKKW-KGVMDAKLSA-N |
| XLogP | 3.68 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.08 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|