About (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone
(2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone (PubChem CID 10199471) has the molecular formula C23H21NO4
and a molecular weight of 375.42 g/mol. Its IUPAC name is (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone.
Molecular Properties
| Compound Name | (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone |
| PubChem CID | 10199471 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1ncc(-c2ccc(OC)cc2)o1 |
| InChI | InChI=1S/C23H21NO4/c1-3-4-8-19-21(17-7-5-6-9-18(17)27-19)22(25)23-24-14-20(28-23)15-10-12-16(26-2)13-11-15/h5-7,9-14H,3-4,8H2,1-2H3 |
| InChIKey | MGFDJAMGLLKDTG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone?
The IUPAC name of (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone (CID 10199471) is (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone.
What is the SMILES notation for (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone?
The canonical SMILES for (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone is CCCCc1oc2ccccc2c1C(=O)c1ncc(-c2ccc(OC)cc2)o1.
What is the InChIKey of (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone?
The InChIKey is MGFDJAMGLLKDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO4/c1-3-4-8-19-21(17-7-5-6-9-18(17)27-19)22(25)23-24-14-20(28-23)15-10-12-16(26-2)13-11-15/h5-7,9-14H,3-4,8H2,1-2H3.
What are the key properties of (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone?
(2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone has a molecular weight of 375.42 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butyl-1-benzofuran-3-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methanone is sourced from PubChem (CID 10199471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).