C16H16F6N2O2 — CID 10199888
2-[4-(5-amino-3-butyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10199888) has the molecular formula C16H16F6N2O2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 2-[4-(5-amino-3-butyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(5-amino-3-butyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10199888 |
| Molecular Formula | C16H16F6N2O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-[4-(5-amino-3-butyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCCc1noc(N)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F6N2O2/c1-2-3-4-11-12(13(23)26-24-11)9-5-7-10(8-6-9)14(25,15(17,18)19)16(20,21)22/h5-8,25H,2-4,23H2,1H3 |
| InChIKey | BZUJURFRSJLREH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |