C20H15F3N4O — CID 10200022
1-(4-methoxyphenyl)-5-(4-pyrrol-1-ylphenyl)-3-(trifluoromethyl)-1,2,4-triazole (PubChem CID 10200022) has the molecular formula C20H15F3N4O and a molecular weight of 384.36 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-(4-pyrrol-1-ylphenyl)-3-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 1-(4-methoxyphenyl)-5-(4-pyrrol-1-ylphenyl)-3-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 10200022 |
| Molecular Formula | C20H15F3N4O |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-(4-pyrrol-1-ylphenyl)-3-(trifluoromethyl)-1,2,4-triazole |
| SMILES | COc1ccc(-n2nc(C(F)(F)F)nc2-c2ccc(-n3cccc3)cc2)cc1 |
| InChI | InChI=1S/C20H15F3N4O/c1-28-17-10-8-16(9-11-17)27-18(24-19(25-27)20(21,22)23)14-4-6-15(7-5-14)26-12-2-3-13-26/h2-13H,1H3 |
| InChIKey | BOWJSIBYIHPCGZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|